cas: 887144-94-7 — see every product listed under this CAS number, including other names
1-(Trifluoromethyl)-1,2-benziodoxol-3(1H)-one, 97%, 97% (CAS 887144-94-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147A8-1g |
| cas | 887144-94-7 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 333.20 Pln | |
| Chemat | 100g | 1149.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(trifluoromethyl)-1lambda3,2-benziodoxol-3-one (CAS 887144-94-7) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 1-(trifluoromethyl)-1lambda3,2-benziodoxol-3-one. InChIKey: XHEOXSQMBWJOKP-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 1-(trifluoromethyl)-1lambda3,2-benziodoxol-3-one |
| InChIKey | XHEOXSQMBWJOKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OI2C(F)(F)F |
Computed by PubChem (NCBI)