cas: 887144-94-7 — see every product listed under this CAS number, including other names
1-Trifluoromethyl-1,2-benziodoxol-3(1H)-one (contains 60% Diatomaceous earth) (CAS 887144-94-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3014-1G |
| cas | 887144-94-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 336.19 Pln | |
| TCI | 5g | 882.01 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
1-(trifluoromethyl)-1lambda3,2-benziodoxol-3-one (CAS 887144-94-7) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 1-(trifluoromethyl)-1lambda3,2-benziodoxol-3-one. InChIKey: XHEOXSQMBWJOKP-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 1-(trifluoromethyl)-1lambda3,2-benziodoxol-3-one |
| InChIKey | XHEOXSQMBWJOKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OI2C(F)(F)F |
Computed by PubChem (NCBI)