cas: 495414-64-7 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-4-hydroxypiperidine-4-carboxylic acid, 98% (CAS 495414-64-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222321-100MG |
| cas | 495414-64-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 1976.41 Pln | |
| Fluorochem | 25g | 4355.78 Pln | |
| Fluorochem | 50g | 7380.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 495414-64-7) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: BLWCMYNTGFJVOC-UHFFFAOYSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | BLWCMYNTGFJVOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)O)O |
Computed by PubChem (NCBI)