CAS 1257850-82-0 appears in our catalog under these names: (S)-N-Boc-morpholine-2-acetic acid, 95%, (S)-2-(4-(tert-Butoxycarbonyl)morpholin-2-yl)acetic acid 95%, (S)-2-(4-(tert-Butoxycarbonyl)morpholin-2-yl)acetic acid, 98%, 98%, (S)-N-Boc-Morpholine-2-acetic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-[(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]acetic acid (CAS 1257850-82-0) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 2-[(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]acetic acid. InChIKey: BBSISPMRGFJLDI-QMMMGPOBSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 2-[(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]acetic acid |
| InChIKey | BBSISPMRGFJLDI-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](C1)CC(=O)O |
Computed by PubChem (NCBI)