cas: 1255666-86-4 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-5,5-difluoropiperidine-3-carboxylic acid, 98%, 98% (CAS 1255666-86-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111NVM-100mg |
| cas | 1255666-86-4 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 500mg | 472.40 Pln | |
| Chemat | 1g | 779.60 Pln | |
| Chemat | 5g | 2901.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 1255666-86-4) is a chemical compound with the molecular formula C11H17F2NO4 and a molecular weight of 265.25 g/mol. IUPAC name: 5,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: MSNKMLCRSUWLHZ-UHFFFAOYSA-N.
| Molecular formula | C11H17F2NO4 |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | 5,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | MSNKMLCRSUWLHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(C1)(F)F)C(=O)O |
Computed by PubChem (NCBI)