CAS 2166031-07-6 appears in our catalog under these names: (3R)-1-[(tert-butoxy)carbonyl]-5,5-difluoropiperidine-3-carboxylic acid, 97%, 97%, (3R)-1-[(TERT-BUTOXY)CARBONYL]-5,5-DIFLUOROPIPERIDINE-3-CARBOXYLIC ACID, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
(3R)-5,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 2166031-07-6) is a chemical compound with the molecular formula C11H17F2NO4 and a molecular weight of 265.25 g/mol. IUPAC name: (3R)-5,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: MSNKMLCRSUWLHZ-SSDOTTSWSA-N.
| Molecular formula | C11H17F2NO4 |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | (3R)-5,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | MSNKMLCRSUWLHZ-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CC(C1)(F)F)C(=O)O |
Computed by PubChem (NCBI)