cas: 874297-78-6 — see every product listed under this CAS number, including other names
1-(tert-Butyl)-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 95%, 95% (CAS 874297-78-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115MGQ-100mg |
| cas | 874297-78-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1096.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-tert-butyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874297-78-6) is a chemical compound with the molecular formula C17H27BN2O3 and a molecular weight of 318.2 g/mol. IUPAC name: 1-tert-butyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: BZMCBGPLSXEWGG-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O3 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 1-tert-butyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | BZMCBGPLSXEWGG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)NC(C)(C)C |
Computed by PubChem (NCBI)