CAS 180903-16-6 is the registry number for 1-(tert-Butyl)-3-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine, 97%. Offered by: Ambeed. Available pack sizes: 1g, 250mg.
1-tert-butyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 180903-16-6) is a chemical compound with the molecular formula C15H17N5 and a molecular weight of 267.33 g/mol. IUPAC name: 1-tert-butyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: MVIHEGXCXLFEMC-UHFFFAOYSA-N.
| Molecular formula | C15H17N5 |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | 1-tert-butyl-3-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | MVIHEGXCXLFEMC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=NC=NC(=C2C(=N1)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)