CAS 1097036-91-3 is the registry number for 5,6-Dimethyl-7-(2-(pyridin-2-yl)ethyl)-1H,4H,7H-pyrrolo(2,3-d)pyrimidin-4-imine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5,6-dimethyl-7-(2-pyridin-2-ylethyl)pyrrolo[2,3-d]pyrimidin-4-amine (CAS 1097036-91-3) is a chemical compound with the molecular formula C15H17N5 and a molecular weight of 267.33 g/mol. IUPAC name: 5,6-dimethyl-7-(2-pyridin-2-ylethyl)pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: KSDZVIGSBJBDKE-UHFFFAOYSA-N.
| Molecular formula | C15H17N5 |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | 5,6-dimethyl-7-(2-pyridin-2-ylethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | KSDZVIGSBJBDKE-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=NC=NC(=C12)N)CCC3=CC=CC=N3)C |
Computed by PubChem (NCBI)