cas: 2246564-39-4 — see every product listed under this CAS number, including other names
1-(tert-butyl)-3-(2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 95%, 95% (CAS 2246564-39-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FTMT-100mg |
| cas | 2246564-39-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 1355.60 Pln | |
| Chemat | 1g | 4715.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-tert-butyl-3-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 2246564-39-4) is a chemical compound with the molecular formula C17H26BClN2O3 and a molecular weight of 352.7 g/mol. IUPAC name: 1-tert-butyl-3-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: SSXYWAMGTDQPIT-UHFFFAOYSA-N.
| Molecular formula | C17H26BClN2O3 |
|---|---|
| Molecular weight | 352.7 g/mol |
| IUPAC name | 1-tert-butyl-3-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | SSXYWAMGTDQPIT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)NC(=O)NC(C)(C)C |
Computed by PubChem (NCBI)