CAS 2724208-44-8 is the registry number for [3-(Piperazine-1-carbonyl)phenyl] boronic acid pinacol ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Piperazin-1-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;hydrochloride (CAS 2724208-44-8) is a chemical compound with the molecular formula C17H26BClN2O3 and a molecular weight of 352.7 g/mol. IUPAC name: piperazin-1-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;hydrochloride. InChIKey: YNHIJHIMTIKNLH-UHFFFAOYSA-N.
| Molecular formula | C17H26BClN2O3 |
|---|---|
| Molecular weight | 352.7 g/mol |
| IUPAC name | piperazin-1-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;hydrochloride |
| InChIKey | YNHIJHIMTIKNLH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)N3CCNCC3.Cl |
Computed by PubChem (NCBI)