cas: 58379-80-9 — see every product listed under this CAS number, including other names
1-[(1-Isocyanoethyl)sulfonyl]-4-methylbenzene 98% (CAS 58379-80-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A912372-250mg |
| cas | 58379-80-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 10g | 909.94 Pln | |
| Ambeed | 25g | 1911.19 Pln | |
| Ambeed | 100g | 5332.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A912372 |
1-(1-isocyanoethylsulfonyl)-4-methylbenzene (CAS 58379-80-9) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: 1-(1-isocyanoethylsulfonyl)-4-methylbenzene. InChIKey: NGOUPILQFWOEET-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 1-(1-isocyanoethylsulfonyl)-4-methylbenzene |
| InChIKey | NGOUPILQFWOEET-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C)[N+]#[C-] |
Computed by PubChem (NCBI)