cas: 58379-80-9 — see every product listed under this CAS number, including other names
Benzene, 1-[(1-isocyanoethyl)sulfonyl]-4-methyl-, 97%, 97% (CAS 58379-80-9) is a chemical reagent available from Chemat. Available pack sizes: 5kg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EB63-5kg |
| cas | 58379-80-9 |
| size | 5kg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5kg | 60278.40 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 491.60 Pln | |
| Chemat | 25g | 1029.20 Pln | |
| Chemat | 50g | 1922.00 Pln | |
| Chemat | 100g | 3506.00 Pln | |
| Chemat | 1kg | 15678.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(1-isocyanoethylsulfonyl)-4-methylbenzene (CAS 58379-80-9) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: 1-(1-isocyanoethylsulfonyl)-4-methylbenzene. InChIKey: NGOUPILQFWOEET-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 1-(1-isocyanoethylsulfonyl)-4-methylbenzene |
| InChIKey | NGOUPILQFWOEET-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C)[N+]#[C-] |
Computed by PubChem (NCBI)