cas: 870703-75-6 — see every product listed under this CAS number, including other names
1-[(4-BROMO-2-FLUOROPHENYL)METHYL]PIPERAZINE, ≥96%, ≥96% (CAS 870703-75-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CY5-250mg |
| cas | 870703-75-6 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1715.60 Pln |
| purity | ≥96% |
|---|---|
| delivery time | 3 weeks |
1-[(4-bromo-2-fluorophenyl)methyl]piperazine (CAS 870703-75-6) is a chemical compound with the molecular formula C11H14BrFN2 and a molecular weight of 273.14 g/mol. IUPAC name: 1-[(4-bromo-2-fluorophenyl)methyl]piperazine. InChIKey: NRCBEINBLSTDHM-UHFFFAOYSA-N.
| Molecular formula | C11H14BrFN2 |
|---|---|
| Molecular weight | 273.14 g/mol |
| IUPAC name | 1-[(4-bromo-2-fluorophenyl)methyl]piperazine |
| InChIKey | NRCBEINBLSTDHM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)