CAS 1365272-64-5 is the registry number for 4-Bromo-1-N-cyclopentyl-5-fluorobenzene-1,2-diamine, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-bromo-1-N-cyclopentyl-5-fluorobenzene-1,2-diamine (CAS 1365272-64-5) is a chemical compound with the molecular formula C11H14BrFN2 and a molecular weight of 273.14 g/mol. IUPAC name: 4-bromo-1-N-cyclopentyl-5-fluorobenzene-1,2-diamine. InChIKey: YTSAEWCCFSDLQP-UHFFFAOYSA-N.
| Molecular formula | C11H14BrFN2 |
|---|---|
| Molecular weight | 273.14 g/mol |
| IUPAC name | 4-bromo-1-N-cyclopentyl-5-fluorobenzene-1,2-diamine |
| InChIKey | YTSAEWCCFSDLQP-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=CC(=C(C=C2N)Br)F |
Computed by PubChem (NCBI)