cas: 21969-12-0 — see every product listed under this CAS number, including other names
1-[(4-Bromophenyl)sulphanyl]-4-nitrobenzene, 96% (CAS 21969-12-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F403399-1G |
| cas | 21969-12-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 440.49 Pln | |
| Fluorochem | 25g | 1356.83 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-bromophenyl)sulfanyl-4-nitrobenzene (CAS 21969-12-0) is a chemical compound with the molecular formula C12H8BrNO2S and a molecular weight of 310.17 g/mol. IUPAC name: 1-(4-bromophenyl)sulfanyl-4-nitrobenzene. InChIKey: XWPBPDJTKDECOY-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2S |
|---|---|
| Molecular weight | 310.17 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfanyl-4-nitrobenzene |
| InChIKey | XWPBPDJTKDECOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])SC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)