CAS 1338543-57-9 appears in our catalog under these names: 9-Bromo-8-methoxythieno(2,3-c)quinolin-4(5H)-one, 97%, 9-Bromo-8-methoxythieno[2,3-c]quinolin-4(5H)-one, 95%, 95%, 9-Bromo-8-methoxythieno[2,3-c]quinolin-4(5H)-one, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
9-bromo-8-methoxy-5H-thieno[2,3-c]quinolin-4-one (CAS 1338543-57-9) is a chemical compound with the molecular formula C12H8BrNO2S and a molecular weight of 310.17 g/mol. IUPAC name: 9-bromo-8-methoxy-5H-thieno[2,3-c]quinolin-4-one. InChIKey: BMQKMQDSAISGQN-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO2S |
|---|---|
| Molecular weight | 310.17 g/mol |
| IUPAC name | 9-bromo-8-methoxy-5H-thieno[2,3-c]quinolin-4-one |
| InChIKey | BMQKMQDSAISGQN-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC(=O)C3=C2C=CS3)Br |
Computed by PubChem (NCBI)