cas: 2005-04-1 — see every product listed under this CAS number, including other names
1-[(4-Chlorophenyl)phenylmethyl]-4-nitrosopiperazine, 95%, 95% (CAS 2005-04-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XAMT-25mg |
| cas | 2005-04-1 |
| size | 25mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 890.00 Pln | |
| Chemat | 100mg | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[(4-chlorophenyl)-phenylmethyl]-4-nitrosopiperazine (CAS 2005-04-1) is a chemical compound with the molecular formula C17H18ClN3O and a molecular weight of 315.8 g/mol. IUPAC name: 1-[(4-chlorophenyl)-phenylmethyl]-4-nitrosopiperazine. InChIKey: ISUJGWTZPVDIHO-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN3O |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)-phenylmethyl]-4-nitrosopiperazine |
| InChIKey | ISUJGWTZPVDIHO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl)N=O |
Computed by PubChem (NCBI)