Products 917369-31-4
CAS 917369-31-4 appears in our catalog under these names: Verubulin hydrochloride, 95%, Verubulin hydrochloride/ 99.77% (existing batch purity), MPC 6827 hydrochloride, MPC 6827 hydrochloride, 95%, 95%, Verubulin (hydrochloride), 98.71%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg.
N-(4-methoxyphenyl)-N,2-dimethylquinazolin-4-amine;hydrochloride (CAS 917369-31-4) is a chemical compound with the molecular formula C17H18ClN3O and a molecular weight of 315.8 g/mol. IUPAC name: N-(4-methoxyphenyl)-N,2-dimethylquinazolin-4-amine;hydrochloride. InChIKey: VYUWDIKZJLOZJL-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN3O |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | N-(4-methoxyphenyl)-N,2-dimethylquinazolin-4-amine;hydrochloride |
| InChIKey | VYUWDIKZJLOZJL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=N1)N(C)C3=CC=C(C=C3)OC.Cl |
Computed by PubChem (NCBI)
Synonyms:
Verubulin hydrochloride, Azixa, Verubulin HCl, N-(4-methoxyphenyl)-n,2-dimethylquinazolin-4-amine hydrochloride, Microtubule Inhibitor MPC-6827, Verubulin (hydrochloride), Verubulin hydrochloride [USAN], N-(4-methoxyphenyl)-N,2-dimethylquinazolin-4-amine;hydrochloride, N-(4-Methoxyphenyl)-N,2-dimethyl-4-quinazolinamine hydrochloride, Verubulin hydrochloride (USAN)