cas: 174606-16-7 — see every product listed under this CAS number, including other names
1-[(TERT-BUTYL)OXYCARBONYL]-3-(4-CHLOROBENZYL)PIPERIDINE-3-CARBOXYLIC ACID, 97% (CAS 174606-16-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305983-250MG |
| cas | 174606-16-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 794.53 Pln | |
| Fluorochem | 1g | 1939.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-[(4-chlorophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 174606-16-7) is a chemical compound with the molecular formula C18H24ClNO4 and a molecular weight of 353.8 g/mol. IUPAC name: 3-[(4-chlorophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: NFBWLXLJPIEKQE-UHFFFAOYSA-N.
| Molecular formula | C18H24ClNO4 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | NFBWLXLJPIEKQE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)(CC2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)