Products 125251-66-3
CAS 125251-66-3 is the registry number for Arbutamine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(1R)-1-hydroxy-2-[4-(4-hydroxyphenyl)butylamino]ethyl]benzene-1,2-diol;hydrochloride (CAS 125251-66-3) is a chemical compound with the molecular formula C18H24ClNO4 and a molecular weight of 353.8 g/mol. IUPAC name: 4-[(1R)-1-hydroxy-2-[4-(4-hydroxyphenyl)butylamino]ethyl]benzene-1,2-diol;hydrochloride. InChIKey: ATBUNPBAFFCFKY-FERBBOLQSA-N.
| Molecular formula | C18H24ClNO4 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 4-[(1R)-1-hydroxy-2-[4-(4-hydroxyphenyl)butylamino]ethyl]benzene-1,2-diol;hydrochloride |
| InChIKey | ATBUNPBAFFCFKY-FERBBOLQSA-N |
| SMILES | C1=CC(=CC=C1CCCCNC[C@@H](C2=CC(=C(C=C2)O)O)O)O.Cl |
Computed by PubChem (NCBI)