cas: 849035-72-9 — see every product listed under this CAS number, including other names
1-[2-Chloro-4-(methylsulfonyl)phenyl]piperazine (CAS 849035-72-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023625-1G |
| cas | 849035-72-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 237.43 Pln |
| delivery time | 2-3 weeks |
|---|
1-(4-chloro-2-methylsulfonylphenyl)piperazine (CAS 849035-72-9) is a chemical compound with the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. IUPAC name: 1-(4-chloro-2-methylsulfonylphenyl)piperazine. InChIKey: RJEDJYJNERXVNE-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2S |
|---|---|
| Molecular weight | 274.77 g/mol |
| IUPAC name | 1-(4-chloro-2-methylsulfonylphenyl)piperazine |
| InChIKey | RJEDJYJNERXVNE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)Cl)N2CCNCC2 |
Computed by PubChem (NCBI)