CAS 849035-72-9 appears in our catalog under these names: 1-[2-Chloro-4-(methylsulfonyl)phenyl]piperazine, 95%, 1-[2-Chloro-4-(methylsulfonyl)phenyl]piperazine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
1-(4-chloro-2-methylsulfonylphenyl)piperazine (CAS 849035-72-9) is a chemical compound with the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. IUPAC name: 1-(4-chloro-2-methylsulfonylphenyl)piperazine. InChIKey: RJEDJYJNERXVNE-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2S |
|---|---|
| Molecular weight | 274.77 g/mol |
| IUPAC name | 1-(4-chloro-2-methylsulfonylphenyl)piperazine |
| InChIKey | RJEDJYJNERXVNE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)Cl)N2CCNCC2 |
Computed by PubChem (NCBI)