cas: 58315-38-1 — see every product listed under this CAS number, including other names
1-[2-Nitro-4-(trifluoromethyl)phenyl]piperazine, 97%, 97% (CAS 58315-38-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EB2B-100mg |
| cas | 58315-38-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 1955.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[2-nitro-4-(trifluoromethyl)phenyl]piperazine (CAS 58315-38-1) is a chemical compound with the molecular formula C11H12F3N3O2 and a molecular weight of 275.23 g/mol. IUPAC name: 1-[2-nitro-4-(trifluoromethyl)phenyl]piperazine. InChIKey: YOBUPGXTLFRIJD-UHFFFAOYSA-N.
| Molecular formula | C11H12F3N3O2 |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | 1-[2-nitro-4-(trifluoromethyl)phenyl]piperazine |
| InChIKey | YOBUPGXTLFRIJD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)