CAS 153204-82-1 is the registry number for 1-(4-Nitro-3-trifluoromethylphenyl)-piperazine, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
1-[4-nitro-3-(trifluoromethyl)phenyl]piperazine (CAS 153204-82-1) is a chemical compound with the molecular formula C11H12F3N3O2 and a molecular weight of 275.23 g/mol. IUPAC name: 1-[4-nitro-3-(trifluoromethyl)phenyl]piperazine. InChIKey: GGXGAQDEUXECHQ-UHFFFAOYSA-N.
| Molecular formula | C11H12F3N3O2 |
|---|---|
| Molecular weight | 275.23 g/mol |
| IUPAC name | 1-[4-nitro-3-(trifluoromethyl)phenyl]piperazine |
| InChIKey | GGXGAQDEUXECHQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=C(C=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)