cas: 22572-40-3 — see every product listed under this CAS number, including other names
1-[3-(Dimethylamino)propyl]-3-ethylcarbodiimide Methiodide, >98.0%(T) (CAS 22572-40-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D5334-5G |
| cas | 22572-40-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 388.79 Pln | |
| TCI | 25g | 1190.31 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
3-(ethyliminomethylideneamino)propyl-trimethylazanium iodide (CAS 22572-40-3) is a chemical compound with the molecular formula C9H20IN3 and a molecular weight of 297.18 g/mol. IUPAC name: 3-(ethyliminomethylideneamino)propyl-trimethylazanium iodide. InChIKey: AGSKWMRPXWHSPF-UHFFFAOYSA-M.
| Molecular formula | C9H20IN3 |
|---|---|
| Molecular weight | 297.18 g/mol |
| IUPAC name | 3-(ethyliminomethylideneamino)propyl-trimethylazanium iodide |
| InChIKey | AGSKWMRPXWHSPF-UHFFFAOYSA-M |
| SMILES | CCN=C=NCCC[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)