cas: 22572-40-3 — see every product listed under this CAS number, including other names
1-[3-(Dimethylamino)propyl]-3-ethylcarbodiimide methiodide, 98% (CAS 22572-40-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038197-1G |
| cas | 22572-40-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 25g | 622.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
3-(ethyliminomethylideneamino)propyl-trimethylazanium iodide (CAS 22572-40-3) is a chemical compound with the molecular formula C9H20IN3 and a molecular weight of 297.18 g/mol. IUPAC name: 3-(ethyliminomethylideneamino)propyl-trimethylazanium iodide. InChIKey: AGSKWMRPXWHSPF-UHFFFAOYSA-M.
| Molecular formula | C9H20IN3 |
|---|---|
| Molecular weight | 297.18 g/mol |
| IUPAC name | 3-(ethyliminomethylideneamino)propyl-trimethylazanium iodide |
| InChIKey | AGSKWMRPXWHSPF-UHFFFAOYSA-M |
| SMILES | CCN=C=NCCC[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)