cas: 943109-41-9 — see every product listed under this CAS number, including other names
1-[4-(3-fluorophenyl)tetrahydro-2H-pyran-4-yl]methanamine, 97% (CAS 943109-41-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F310654-250MG |
| cas | 943109-41-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1247.50 Pln | |
| Fluorochem | 1g | 2720.93 Pln | |
| Fluorochem | 5g | 8000.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[4-(3-fluorophenyl)oxan-4-yl]methanamine (CAS 943109-41-9) is a chemical compound with the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. IUPAC name: [4-(3-fluorophenyl)oxan-4-yl]methanamine. InChIKey: SZTJIHCPVBNZCD-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO |
|---|---|
| Molecular weight | 209.26 g/mol |
| IUPAC name | [4-(3-fluorophenyl)oxan-4-yl]methanamine |
| InChIKey | SZTJIHCPVBNZCD-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CN)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)