CAS 92636-38-9 appears in our catalog under these names: 1-[4-(TRIFLUOROMETHYL)PHENYL]-1H-PYRROLE, 97%, 97%, 1-(4-(Trifluoromethyl)phenyl)-1H-pyrrole. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
1-[4-(trifluoromethyl)phenyl]pyrrole (CAS 92636-38-9) is a chemical compound with the molecular formula C11H8F3N and a molecular weight of 211.18 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]pyrrole. InChIKey: JFGOCJGHXODFKU-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]pyrrole |
| InChIKey | JFGOCJGHXODFKU-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)