cas: 1391586-30-3 — see every product listed under this CAS number, including other names
1-{4-[(2R)-2-carboxy-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]phenyl}triaz-2-yn-2-ium-1-ide, 97% (CAS 1391586-30-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F769351-1G |
| cas | 1391586-30-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3012.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-3-(4-azidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1391586-30-3) is a chemical compound with the molecular formula C24H20N4O4 and a molecular weight of 428.4 g/mol. IUPAC name: (2R)-3-(4-azidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: FDDCQWPWXJJNFA-JOCHJYFZSA-N.
| Molecular formula | C24H20N4O4 |
|---|---|
| Molecular weight | 428.4 g/mol |
| IUPAC name | (2R)-3-(4-azidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | FDDCQWPWXJJNFA-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC=C(C=C4)N=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)