Products 1391586-30-3

CAS 1391586-30-3 appears in our catalog under these names: Fmoc-d-4-azidophe, 95%, Fmoc–p–azido–D–Phe–OH, Fmoc-D-Phe(4-N3)-OH. Offered by: Combi-blocks, GLPBio, Iris Biotech. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 500mg.

Structural formula: {0} (CAS {1})

(2R)-3-(4-azidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1391586-30-3) is a chemical compound with the molecular formula C24H20N4O4 and a molecular weight of 428.4 g/mol. IUPAC name: (2R)-3-(4-azidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: FDDCQWPWXJJNFA-JOCHJYFZSA-N.

Identity
Molecular formulaC24H20N4O4
Molecular weight428.4 g/mol
IUPAC name(2R)-3-(4-azidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid
InChIKeyFDDCQWPWXJJNFA-JOCHJYFZSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC=C(C=C4)N=[N+]=[N-])C(=O)O

Computed by PubChem (NCBI)