cas: 1268520-12-2 — see every product listed under this CAS number, including other names
1-Acetyl-2-methyl-D-proline, 95%, 95% (CAS 1268520-12-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110YYE-250mg |
| cas | 1268520-12-2 |
| size | 250mg |
| availability | 37.35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 870.80 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 25g | 6126.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-1-acetyl-2-methylpyrrolidine-2-carboxylic acid (CAS 1268520-12-2) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: (2R)-1-acetyl-2-methylpyrrolidine-2-carboxylic acid. InChIKey: VOSYPKQVDFIHEJ-MRVPVSSYSA-N.
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | (2R)-1-acetyl-2-methylpyrrolidine-2-carboxylic acid |
| InChIKey | VOSYPKQVDFIHEJ-MRVPVSSYSA-N |
| SMILES | CC(=O)N1CCC[C@]1(C)C(=O)O |
Computed by PubChem (NCBI)