cas: 16887-36-8 — see every product listed under this CAS number, including other names
1-Adamantyl Methacrylate 95% GC (stabilized with MEHQ) (CAS 16887-36-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A385860-1g |
| cas | 16887-36-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 10g | 537.25 Pln | |
| Ambeed | 25g | 960.00 Pln | |
| Ambeed | 100g | 2428.50 Pln |
| purity | 95% GC (stabilized with MEHQ) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A385860 |
1-adamantyl 2-methylprop-2-enoate (CAS 16887-36-8) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 1-adamantyl 2-methylprop-2-enoate. InChIKey: MZVABYGYVXBZDP-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 1-adamantyl 2-methylprop-2-enoate |
| InChIKey | MZVABYGYVXBZDP-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)