Products 66735-04-4

CAS 66735-04-4 is the registry number for 3-(4-tert-Butylphenyl)-2-methylpropanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(4-tert-butylphenyl)-2-methylpropanoic acid (CAS 66735-04-4) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 3-(4-tert-butylphenyl)-2-methylpropanoic acid. InChIKey: DWZYELZGJMFEMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20O2
Molecular weight220.31 g/mol
IUPAC name3-(4-tert-butylphenyl)-2-methylpropanoic acid
InChIKeyDWZYELZGJMFEMJ-UHFFFAOYSA-N
SMILESCC(CC1=CC=C(C=C1)C(C)(C)C)C(=O)O

Computed by PubChem (NCBI)