cas: 669008-27-9 — see every product listed under this CAS number, including other names
1-Allyl-N-(tert-butyl)cyclopropane-1-sulfonamide 95% +(stabilized with TBC) (CAS 669008-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1161342-100mg |
| cas | 669008-27-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 798.69 Pln | |
| Ambeed | 1g | 1911.19 Pln |
| purity | 95% +(stabilized with TBC) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1161342 |
N-tert-butyl-1-prop-2-enylcyclopropane-1-sulfonamide (CAS 669008-27-9) is a chemical compound with the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. IUPAC name: N-tert-butyl-1-prop-2-enylcyclopropane-1-sulfonamide. InChIKey: ZLTSXSSISAWHIK-UHFFFAOYSA-N.
| Molecular formula | C10H19NO2S |
|---|---|
| Molecular weight | 217.33 g/mol |
| IUPAC name | N-tert-butyl-1-prop-2-enylcyclopropane-1-sulfonamide |
| InChIKey | ZLTSXSSISAWHIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1(CC1)CC=C |
Computed by PubChem (NCBI)