cas: 1191078-74-6 — see every product listed under this CAS number, including other names
1-Amino-3,6,9,12,15-pentaoxaoctadecan-18-oic acid, 96%, 96% (CAS 1191078-74-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HEXV-50mg |
| cas | 1191078-74-6 |
| size | 50mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 155.60 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 938.00 Pln | |
| Chemat | 10g | 1658.00 Pln | |
| Chemat | 25g | 3251.60 Pln | |
| Chemat | 50g | 6266.00 Pln | |
| Chemat | 100g | 10269.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1191078-74-6) is a chemical compound with the molecular formula C13H27NO7 and a molecular weight of 309.36 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ZTYIBTVLGAIXDY-UHFFFAOYSA-N.
| Molecular formula | C13H27NO7 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ZTYIBTVLGAIXDY-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCN)C(=O)O |
Computed by PubChem (NCBI)