Amino-PEG5-C2-acid, 97.0%
cas: 1191078-74-6 — see every product listed under this CAS number, including other names
Amino-PEG5-C2-acid, 97.0% (CAS 1191078-74-6) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 1 g, 50 mg, 5 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-115384-100 mg |
| cas | 1191078-74-6 |
| size | 100 mg |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 459.01 Pln | |
| MedChemExpress | 1 g | 825.89 Pln | |
| MedChemExpress | 50 mg | 356.84 Pln | |
| MedChemExpress | 5 g | 3045.72 Pln | |
| MedChemExpress | 250 mg | 654.06 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.0% |
3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1191078-74-6) is a chemical compound with the molecular formula C13H27NO7 and a molecular weight of 309.36 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ZTYIBTVLGAIXDY-UHFFFAOYSA-N.
| Molecular formula | C13H27NO7 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ZTYIBTVLGAIXDY-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCN)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Amino-PEG5-acid, Amino-PEG5-C2-acid, Amino-PEG5-COOH, Amino-PEG5-propionic Acid, Amine-PEG5-COOH, 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid, orb1909525, Amino-PEG5-acid,H2N-PEG5-COOH, 4,7,10,13,16-Pentaoxaoctadecanoic acid, 18-amino-, alpha,omega-amine--propionic acid pentaethylene glycol