cas: 41403-84-3 — see every product listed under this CAS number, including other names
1-Amino-3-(4-tert-butyl-phenoxy)-propan-2-ol, 97% (CAS 41403-84-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F058056-500MG |
| cas | 41403-84-3 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1013.20 Pln | |
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 633.13 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-amino-3-(4-tert-butylphenoxy)propan-2-ol (CAS 41403-84-3) is a chemical compound with the molecular formula C13H21NO2 and a molecular weight of 223.31 g/mol. IUPAC name: 1-amino-3-(4-tert-butylphenoxy)propan-2-ol. InChIKey: LPNCSYWIVAILJB-UHFFFAOYSA-N.
| Molecular formula | C13H21NO2 |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | 1-amino-3-(4-tert-butylphenoxy)propan-2-ol |
| InChIKey | LPNCSYWIVAILJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OCC(CN)O |
Computed by PubChem (NCBI)