CAS 95975-81-8 appears in our catalog under these names: Alpha-aminotricyclo[3.3.1.1(3,7)]decane-1-propanoic acid, 95%, 3–(Adamantan–1–yl)–2–aminopropanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
3-(1-adamantyl)-2-aminopropanoic acid (CAS 95975-81-8) is a chemical compound with the molecular formula C13H21NO2 and a molecular weight of 223.31 g/mol. IUPAC name: 3-(1-adamantyl)-2-aminopropanoic acid. InChIKey: ZAQXSMCYFQJRCQ-UHFFFAOYSA-N.
| Molecular formula | C13H21NO2 |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | 3-(1-adamantyl)-2-aminopropanoic acid |
| InChIKey | ZAQXSMCYFQJRCQ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CC(C(=O)O)N |
Computed by PubChem (NCBI)