cas: 133891-86-8 — see every product listed under this CAS number, including other names
1-BENZHYDRYL-3-METHYLAZETIDIN-3-OL HCL, 80% (CAS 133891-86-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F389945-5G |
| cas | 133891-86-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 25g | 1153.78 Pln | |
| Fluorochem | 100g | 2845.89 Pln | |
| Fluorochem | 10g | 539.41 Pln |
| purity | 80% |
|---|---|
| delivery time | 3-4 weeks |
1-benzhydryl-3-methylazetidin-3-ol;hydrochloride (CAS 133891-86-8) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 289.8 g/mol. IUPAC name: 1-benzhydryl-3-methylazetidin-3-ol;hydrochloride. InChIKey: ASMPVJOSECQRDB-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 1-benzhydryl-3-methylazetidin-3-ol;hydrochloride |
| InChIKey | ASMPVJOSECQRDB-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3)O.Cl |
Computed by PubChem (NCBI)