CAS 133891-86-8 appears in our catalog under these names: 1-(Diphenylmethyl)-3-methyl-3-azetidinol hydrochloride, 97%, 1-Benzhydryl-3-methylazetidin-3-ol hydrochloride, 97%, 1-BENZHYDRYL-3-METHYLAZETIDIN-3-OL HCL, 80%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g, 10g.
1-benzhydryl-3-methylazetidin-3-ol;hydrochloride (CAS 133891-86-8) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 289.8 g/mol. IUPAC name: 1-benzhydryl-3-methylazetidin-3-ol;hydrochloride. InChIKey: ASMPVJOSECQRDB-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 1-benzhydryl-3-methylazetidin-3-ol;hydrochloride |
| InChIKey | ASMPVJOSECQRDB-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3)O.Cl |
Computed by PubChem (NCBI)