cas: 1427475-28-2 — see every product listed under this CAS number, including other names
1-BENZYLPYRAZOLE-3-CARBONITRILE (CAS 1427475-28-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387132-100MG |
| cas | 1427475-28-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 877.83 Pln | |
| Fluorochem | 1g | 2064.92 Pln | |
| Fluorochem | 5g | 5579.30 Pln |
| delivery time | 3-4 weeks |
|---|
1-benzylpyrazole-3-carbonitrile (CAS 1427475-28-2) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. IUPAC name: 1-benzylpyrazole-3-carbonitrile. InChIKey: JVLQVIPFAWLBCD-UHFFFAOYSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 1-benzylpyrazole-3-carbonitrile |
| InChIKey | JVLQVIPFAWLBCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC(=N2)C#N |
Computed by PubChem (NCBI)