CAS 73834-77-2 appears in our catalog under these names: 3-Amino-9h-pyrido[3,4-b]indole, 95%, 9H-Pyrido(3,4-b)indol-3-amine, 98%, 3–Amino–9H–pyrido(3,4–b)indole, 3-Amino-9H-pyrido[3,4-b]indole, >98.0%(HPLC)(T), 9H-Pyrido[3,4-b]indol-3-amine, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg.
9H-pyrido[3,4-b]indol-3-amine (CAS 73834-77-2) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. IUPAC name: 9H-pyrido[3,4-b]indol-3-amine. InChIKey: UGMPOJSWOINMDE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 9H-pyrido[3,4-b]indol-3-amine |
| InChIKey | UGMPOJSWOINMDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=NC=C3N2)N |
Computed by PubChem (NCBI)