cas: 960294-14-8 — see every product listed under this CAS number, including other names
1-BOC-1,7-DIAZA-SPIRO[4.5]DECANE, 97% (CAS 960294-14-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300606-100MG |
| cas | 960294-14-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 846.59 Pln | |
| Fluorochem | 1g | 1903.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 1,9-diazaspiro[4.5]decane-1-carboxylate (CAS 960294-14-8) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl 1,9-diazaspiro[4.5]decane-1-carboxylate. InChIKey: DVVJBQZUAYJBAX-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl 1,9-diazaspiro[4.5]decane-1-carboxylate |
| InChIKey | DVVJBQZUAYJBAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC12CCCNC2 |
Computed by PubChem (NCBI)