cas: 960294-14-8 — see every product listed under this CAS number, including other names
tert-Butyl 1,7-diazaspiro[4.5]decane-1-carboxylate, 97%, 97% (CAS 960294-14-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJR3-100mg |
| cas | 960294-14-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 726.80 Pln | |
| Chemat | 1g | 1245.20 Pln | |
| Chemat | 5g | 4542.80 Pln | |
| Chemat | 10g | 7643.60 Pln | |
| Chemat | 25g | 16946.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 1,9-diazaspiro[4.5]decane-1-carboxylate (CAS 960294-14-8) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl 1,9-diazaspiro[4.5]decane-1-carboxylate. InChIKey: DVVJBQZUAYJBAX-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl 1,9-diazaspiro[4.5]decane-1-carboxylate |
| InChIKey | DVVJBQZUAYJBAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC12CCCNC2 |
Computed by PubChem (NCBI)