cas: 936850-09-8 — see every product listed under this CAS number, including other names
1-BOC-3-CYANO-3-METHYLAZETIDINE, 97% (CAS 936850-09-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330798-1G |
| cas | 936850-09-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1466.17 Pln | |
| Fluorochem | 10g | 2538.71 Pln | |
| Fluorochem | 25g | 4688.99 Pln | |
| Fluorochem | 100g | 12378.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-cyano-3-methylazetidine-1-carboxylate (CAS 936850-09-8) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: tert-butyl 3-cyano-3-methylazetidine-1-carboxylate. InChIKey: KRXUECUCCJEQAJ-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | tert-butyl 3-cyano-3-methylazetidine-1-carboxylate |
| InChIKey | KRXUECUCCJEQAJ-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(=O)OC(C)(C)C)C#N |
Computed by PubChem (NCBI)