cas: 1198283-93-0 — see every product listed under this CAS number, including other names
1-BOC-4-(2-BROMOPHENYL)PIPERIDINE, 95%, 95% (CAS 1198283-93-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PQP-100mg |
| cas | 1198283-93-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1101.20 Pln | |
| Chemat | 5g | 3707.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(2-bromophenyl)piperidine-1-carboxylate (CAS 1198283-93-0) is a chemical compound with the molecular formula C16H22BrNO2 and a molecular weight of 340.25 g/mol. IUPAC name: tert-butyl 4-(2-bromophenyl)piperidine-1-carboxylate. InChIKey: LRXFQBYMFQBMFB-UHFFFAOYSA-N.
| Molecular formula | C16H22BrNO2 |
|---|---|
| Molecular weight | 340.25 g/mol |
| IUPAC name | tert-butyl 4-(2-bromophenyl)piperidine-1-carboxylate |
| InChIKey | LRXFQBYMFQBMFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)