CAS 2270906-20-0 is the registry number for (2-Bromo-4-methyl-benzyl)-cyclopropyl-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl N-[(2-bromo-4-methylphenyl)methyl]-N-cyclopropylcarbamate (CAS 2270906-20-0) is a chemical compound with the molecular formula C16H22BrNO2 and a molecular weight of 340.25 g/mol. IUPAC name: tert-butyl N-[(2-bromo-4-methylphenyl)methyl]-N-cyclopropylcarbamate. InChIKey: ASCBPLADBWZJCW-UHFFFAOYSA-N.
| Molecular formula | C16H22BrNO2 |
|---|---|
| Molecular weight | 340.25 g/mol |
| IUPAC name | tert-butyl N-[(2-bromo-4-methylphenyl)methyl]-N-cyclopropylcarbamate |
| InChIKey | ASCBPLADBWZJCW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CN(C2CC2)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)