1-BOC-6-methylindole-2-boronic acid, pinacol ester, 95%, 95%
cas: 1218791-10-6 — see every product listed under this CAS number, including other names
1-BOC-6-methylindole-2-boronic acid, pinacol ester, 95%, 95% (CAS 1218791-10-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127AY-100mg |
| cas | 1218791-10-6 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2334.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 1218791-10-6) is a chemical compound with the molecular formula C20H28BNO4 and a molecular weight of 357.3 g/mol. IUPAC name: tert-butyl 6-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: DLJSHMNWOLUBTQ-UHFFFAOYSA-N.
| Molecular formula | C20H28BNO4 |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | tert-butyl 6-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | DLJSHMNWOLUBTQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2C(=O)OC(C)(C)C)C=C(C=C3)C |
Computed by PubChem (NCBI)