CAS 869852-13-1 appears in our catalog under these names: 1-BOC-3-Methylindole-2-boronic acid pinacol ester, 98%, 1-BOC-3-Methylindole-2-boronic acid pinacol ester, 95-<97%, 1-BOC-3-Methylindole-2-boronic acid pinacol ester, ≥97-<99%, 1-BOC-3-Methylindole-2-boronic acid pinacol ester, tert-Butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100mg, 250mg.
Tert-butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 869852-13-1) is a chemical compound with the molecular formula C20H28BNO4 and a molecular weight of 357.3 g/mol. IUPAC name: tert-butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: XYUZBXNCRMPFHN-UHFFFAOYSA-N.
| Molecular formula | C20H28BNO4 |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | tert-butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | XYUZBXNCRMPFHN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C3=CC=CC=C3N2C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)